C15H17N3O5 — CID 163136411
5-[(2,3-dimethylphenyl)carbamoyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 163136411) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 5-[(2,3-dimethylphenyl)carbamoyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 5-[(2,3-dimethylphenyl)carbamoyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163136411 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 5-[(2,3-dimethylphenyl)carbamoyl]-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | Cc1cccc(NC(=O)c2cc([NH+]([O-])O)cc([NH+]([O-])O)c2)c1C |
| InChI | InChI=1S/C15H17N3O5/c1-9-4-3-5-14(10(9)2)16-15(19)11-6-12(17(20)21)8-13(7-11)18(22)23/h3-8,17-18,20,22H,1-2H3,(H,16,19) |
| InChIKey | ICQMYPLIWSADTM-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|