C22H35N2O2S- — CID 163137116
[(1R,2R,4aS,5S,8S,8aS)-2-hydroxy-5-isothiocyanato-2,5-dimethyl-8-[(2R,5S)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-methylazanide (PubChem CID 163137116) has the molecular formula C22H35N2O2S- and a molecular weight of 391.60 g/mol. Its IUPAC name is [(1R,2R,4aS,5S,8S,8aS)-2-hydroxy-5-isothiocyanato-2,5-dimethyl-8-[(2R,5S)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-methylazanide.
| Compound Name | [(1R,2R,4aS,5S,8S,8aS)-2-hydroxy-5-isothiocyanato-2,5-dimethyl-8-[(2R,5S)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-methylazanide |
|---|---|
| PubChem CID | 163137116 |
| Molecular Formula | C22H35N2O2S- |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | [(1R,2R,4aS,5S,8S,8aS)-2-hydroxy-5-isothiocyanato-2,5-dimethyl-8-[(2R,5S)-2-methyl-5-prop-1-en-2-yloxolan-2-yl]-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-methylazanide |
| SMILES | C=C(C)[C@@H]1CC[C@](C)([C@H]2CC[C@](C)(N=C=S)[C@H]3CC[C@@](C)(O)[C@H]([N-]C)[C@H]23)O1 |
| InChI | InChI=1S/C22H35N2O2S/c1-14(2)17-9-12-22(5,26-17)16-7-10-20(3,24-13-27)15-8-11-21(4,25)19(23-6)18(15)16/h15-19,25H,1,7-12H2,2-6H3/q-1/t15-,16-,17-,18-,19+,20-,21+,22+/m0/s1 |
| InChIKey | NYJXINAHBBWMCC-WQAUDIEISA-N |
| XLogP | 4.92 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|