C30H46O3 — CID 163137396
6-[2-(2,5,5,8a-tetramethyl-6-oxo-7,8-dihydro-3H-naphthalen-1-yl)ethyl]-2,2,5a,7-tetramethyl-5,6,7,8,9,9a-hexahydro-4H-benzo[b]oxepin-3-one (PubChem CID 163137396) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is 6-[2-(2,5,5,8a-tetramethyl-6-oxo-7,8-dihydro-3H-naphthalen-1-yl)ethyl]-2,2,5a,7-tetramethyl-5,6,7,8,9,9a-hexahydro-4H-benzo[b]oxepin-3-one.
| Compound Name | 6-[2-(2,5,5,8a-tetramethyl-6-oxo-7,8-dihydro-3H-naphthalen-1-yl)ethyl]-2,2,5a,7-tetramethyl-5,6,7,8,9,9a-hexahydro-4H-benzo[b]oxepin-3-one |
|---|---|
| PubChem CID | 163137396 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 6-[2-(2,5,5,8a-tetramethyl-6-oxo-7,8-dihydro-3H-naphthalen-1-yl)ethyl]-2,2,5a,7-tetramethyl-5,6,7,8,9,9a-hexahydro-4H-benzo[b]oxepin-3-one |
| SMILES | CC1=C(CCC2C(C)CCC3OC(C)(C)C(=O)CCC32C)C2(C)CCC(=O)C(C)(C)C2=CC1 |
| InChI | InChI=1S/C30H46O3/c1-19-9-13-23-27(3,4)24(31)15-17-29(23,7)21(19)11-12-22-20(2)10-14-26-30(22,8)18-16-25(32)28(5,6)33-26/h13,20,22,26H,9-12,14-18H2,1-8H3 |
| InChIKey | IMFOFOZCNDFYDV-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|