C26H45FN6O2 — CID 163137526
7-[(4-fluorocyclohexyl)methylamino]-4-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 163137526) has the molecular formula C26H45FN6O2 and a molecular weight of 492.68 g/mol. Its IUPAC name is 7-[(4-fluorocyclohexyl)methylamino]-4-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | 7-[(4-fluorocyclohexyl)methylamino]-4-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 163137526 |
| Molecular Formula | C26H45FN6O2 |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.36 |
| IUPAC Name | 7-[(4-fluorocyclohexyl)methylamino]-4-[3-oxo-3-(4-piperidin-2-ylpiperazin-1-yl)propyl]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | O=C1NCC(CCC(=O)N2CCN(C3CCCCN3)CC2)N2CC(NCC3CCC(F)CC3)CC12 |
| InChI | InChI=1S/C26H45FN6O2/c27-20-6-4-19(5-7-20)16-29-21-15-23-26(35)30-17-22(33(23)18-21)8-9-25(34)32-13-11-31(12-14-32)24-3-1-2-10-28-24/h19-24,28-29H,1-18H2,(H,30,35) |
| InChIKey | POZYFVLHIPSCRU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |