About (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide
(2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide (PubChem CID 163137963) has the molecular formula C7H7N2O2-
and a molecular weight of 151.14 g/mol. Its IUPAC name is (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide.
Molecular Properties
| Compound Name | (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide |
| PubChem CID | 163137963 |
| Molecular Formula | C7H7N2O2- |
| Molecular Weight | 151.14 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide |
| SMILES | COC1=CC(=O)C=CC1N=[N-] |
| InChI | InChI=1S/C7H7N2O2/c1-11-7-4-5(10)2-3-6(7)9-8/h2-4,6H,1H3/q-1 |
| InChIKey | ODKVIOWOZFNMEO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.14 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide?
The IUPAC name of (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide (CID 163137963) is (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide.
What is the SMILES notation for (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide?
The canonical SMILES for (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide is COC1=CC(=O)C=CC1N=[N-].
What is the InChIKey of (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide?
The InChIKey is ODKVIOWOZFNMEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2O2/c1-11-7-4-5(10)2-3-6(7)9-8/h2-4,6H,1H3/q-1.
What are the key properties of (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide?
(2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide has a molecular weight of 151.14 g/mol, XLogP of 1.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-4-oxocyclohexa-2,5-dien-1-yl)iminoazanide is sourced from PubChem (CID 163137963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).