C26H38O3 — CID 163138307
(2R)-4-ethyl-2-[(1E,5E,8E,10E)-6-ethyl-2,10,14-trimethylpentadeca-1,5,8,10,13-pentaenyl]-3-hydroxy-2H-furan-5-one (PubChem CID 163138307) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (2R)-4-ethyl-2-[(1E,5E,8E,10E)-6-ethyl-2,10,14-trimethylpentadeca-1,5,8,10,13-pentaenyl]-3-hydroxy-2H-furan-5-one.
| Compound Name | (2R)-4-ethyl-2-[(1E,5E,8E,10E)-6-ethyl-2,10,14-trimethylpentadeca-1,5,8,10,13-pentaenyl]-3-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 163138307 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (2R)-4-ethyl-2-[(1E,5E,8E,10E)-6-ethyl-2,10,14-trimethylpentadeca-1,5,8,10,13-pentaenyl]-3-hydroxy-2H-furan-5-one |
| SMILES | CCC1=C(O)[C@@H](/C=C(\C)CC/C=C(\CC)C/C=C/C(C)=C/CC=C(C)C)OC1=O |
| InChI | InChI=1S/C26H38O3/c1-7-22(16-10-14-20(5)13-9-12-19(3)4)17-11-15-21(6)18-24-25(27)23(8-2)26(28)29-24/h10,12-14,17-18,24,27H,7-9,11,15-16H2,1-6H3/b14-10+,20-13+,21-18+,22-17+/t24-/m1/s1 |
| InChIKey | IUZJXYHKYQYTQA-NDGKWNSESA-N |
| XLogP | 7.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|