C28H36O9 — CID 163140214
[6-(furan-3-yl)-4,12,19-trihydroxy-5,11,15-trimethyl-3-oxo-9,17-dioxahexacyclo[13.3.3.01,14.02,11.05,10.08,10]henicosan-21-yl] acetate (PubChem CID 163140214) has the molecular formula C28H36O9 and a molecular weight of 516.59 g/mol. Its IUPAC name is [6-(furan-3-yl)-4,12,19-trihydroxy-5,11,15-trimethyl-3-oxo-9,17-dioxahexacyclo[13.3.3.01,14.02,11.05,10.08,10]henicosan-21-yl] acetate.
| Compound Name | [6-(furan-3-yl)-4,12,19-trihydroxy-5,11,15-trimethyl-3-oxo-9,17-dioxahexacyclo[13.3.3.01,14.02,11.05,10.08,10]henicosan-21-yl] acetate |
|---|---|
| PubChem CID | 163140214 |
| Molecular Formula | C28H36O9 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | [6-(furan-3-yl)-4,12,19-trihydroxy-5,11,15-trimethyl-3-oxo-9,17-dioxahexacyclo[13.3.3.01,14.02,11.05,10.08,10]henicosan-21-yl] acetate |
| SMILES | CC(=O)OC1CC(O)C23COCC1(C)C2CC(O)C1(C)C3C(=O)C(O)C2(C)C(c3ccoc3)CC3OC321 |
| InChI | InChI=1S/C28H36O9/c1-13(29)36-19-9-18(31)27-12-35-11-24(19,2)16(27)8-17(30)26(4)22(27)21(32)23(33)25(3)15(14-5-6-34-10-14)7-20-28(25,26)37-20/h5-6,10,15-20,22-23,30-31,33H,7-9,11-12H2,1-4H3 |
| InChIKey | JNDKKEJUGVBPDJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|