C23H25N4O4- — CID 163140241
(9S)-5-[hydroxy(oxido)amino]-11-[3-(1-methylindol-3-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 163140241) has the molecular formula C23H25N4O4- and a molecular weight of 421.48 g/mol. Its IUPAC name is (9S)-5-[hydroxy(oxido)amino]-11-[3-(1-methylindol-3-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (9S)-5-[hydroxy(oxido)amino]-11-[3-(1-methylindol-3-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 163140241 |
| Molecular Formula | C23H25N4O4- |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (9S)-5-[hydroxy(oxido)amino]-11-[3-(1-methylindol-3-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cn1cc(CCC(=O)N2CC3C[C@@H](C2)Cn2c3ccc(N([O-])O)c2=O)c2ccccc21 |
| InChI | InChI=1S/C23H25N4O4/c1-24-13-16(18-4-2-3-5-20(18)24)6-9-22(28)25-11-15-10-17(14-25)19-7-8-21(27(30)31)23(29)26(19)12-15/h2-5,7-8,13,15,17,30H,6,9-12,14H2,1H3/q-1/t15-,17?/m0/s1 |
| InChIKey | KXVXBNFXPJITGL-MYJWUSKBSA-N |
| XLogP | 2.61 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|