C24H21FN2O6 — CID 163140496
5-[2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2-fluoro-N-hydroxybenzeneamine oxide (PubChem CID 163140496) has the molecular formula C24H21FN2O6 and a molecular weight of 452.44 g/mol. Its IUPAC name is 5-[2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2-fluoro-N-hydroxybenzeneamine oxide.
| Compound Name | 5-[2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2-fluoro-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163140496 |
| Molecular Formula | C24H21FN2O6 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 5-[2-carboxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2-fluoro-N-hydroxybenzeneamine oxide |
| SMILES | O=C(NC(Cc1ccc(F)c([NH+]([O-])O)c1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H21FN2O6/c25-20-10-9-14(12-22(20)27(31)32)11-21(23(28)29)26-24(30)33-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-10,12,19,21,27,31H,11,13H2,(H,26,30)(H,28,29) |
| InChIKey | JPFKCCXUFGRKAQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|