C34H45NO12 — CID 163140891
[8,14-diacetyloxy-5,7-dihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate (PubChem CID 163140891) has the molecular formula C34H45NO12 and a molecular weight of 659.73 g/mol. Its IUPAC name is [8,14-diacetyloxy-5,7-dihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate.
| Compound Name | [8,14-diacetyloxy-5,7-dihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate |
|---|---|
| PubChem CID | 163140891 |
| Molecular Formula | C34H45NO12 |
| Molecular Weight | 659.73 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | [8,14-diacetyloxy-5,7-dihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate |
| SMILES | COCC12CNC3C4C(OC)C1C3(C(OC)CC2OC(C)=O)C1CC2(O)C(OC)C(O)C4(OC(C)=O)C1C2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H45NO12/c1-16(36)45-20-12-21(42-4)33-19-13-32(40)28(46-30(39)18-10-8-7-9-11-18)22(19)34(47-17(2)37,27(38)29(32)44-6)23-24(43-5)25(33)31(20,15-41-3)14-35-26(23)33/h7-11,19-29,35,38,40H,12-15H2,1-6H3 |
| InChIKey | JSXUPPPZNVPLFP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 168.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.73 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|