C23H35NO6 — CID 163140969
3-[14-hydroxy-3-[hydroxy(oxido)azaniumyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-5-oxo-2H-furan (PubChem CID 163140969) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is 3-[14-hydroxy-3-[hydroxy(oxido)azaniumyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-5-oxo-2H-furan.
| Compound Name | 3-[14-hydroxy-3-[hydroxy(oxido)azaniumyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-5-oxo-2H-furan |
|---|---|
| PubChem CID | 163140969 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 3-[14-hydroxy-3-[hydroxy(oxido)azaniumyl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-5-oxo-2H-furan |
| SMILES | CC12CCC(O[NH+]([O-])O)CC1CCC1C2CCC2(C)C(C3=CC(=O)OC3)CCC12O |
| InChI | InChI=1S/C23H35NO6/c1-21-8-5-16(30-24(27)28)12-15(21)3-4-19-18(21)6-9-22(2)17(7-10-23(19,22)26)14-11-20(25)29-13-14/h11,15-19,24,26-27H,3-10,12-13H2,1-2H3 |
| InChIKey | JTTDDOMONGGOMP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 103.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|