C19H18N3O8S- — CID 163141358
(6R,7S)-3-(acetyloxymethyl)-7-[[(E)-3-[2-[hydroxy(oxido)amino]phenyl]prop-2-enoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 163141358) has the molecular formula C19H18N3O8S- and a molecular weight of 448.43 g/mol. Its IUPAC name is (6R,7S)-3-(acetyloxymethyl)-7-[[(E)-3-[2-[hydroxy(oxido)amino]phenyl]prop-2-enoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-3-(acetyloxymethyl)-7-[[(E)-3-[2-[hydroxy(oxido)amino]phenyl]prop-2-enoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 163141358 |
| Molecular Formula | C19H18N3O8S- |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | (6R,7S)-3-(acetyloxymethyl)-7-[[(E)-3-[2-[hydroxy(oxido)amino]phenyl]prop-2-enoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)[C@H](NC(=O)/C=C/c3ccccc3N([O-])O)[C@H]2SC1 |
| InChI | InChI=1S/C19H18N3O8S/c1-10(23)30-8-12-9-31-18-15(17(25)21(18)16(12)19(26)27)20-14(24)7-6-11-4-2-3-5-13(11)22(28)29/h2-7,15,18,28H,8-9H2,1H3,(H,20,24)(H,26,27)/q-1/b7-6+/t15-,18+/m0/s1 |
| InChIKey | VLTGNQRVOKJVBK-XDWWLABZSA-N |
| XLogP | 0.69 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|