C12H23NO9S2 — CID 163142170
sulfo N-(2-methylbutyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylmethanimidate (PubChem CID 163142170) has the molecular formula C12H23NO9S2 and a molecular weight of 389.45 g/mol. Its IUPAC name is sulfo N-(2-methylbutyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylmethanimidate.
| Compound Name | sulfo N-(2-methylbutyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylmethanimidate |
|---|---|
| PubChem CID | 163142170 |
| Molecular Formula | C12H23NO9S2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | sulfo N-(2-methylbutyl)-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylmethanimidate |
| SMILES | CCC(C)C/N=C(\OS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C12H23NO9S2/c1-3-6(2)4-13-12(22-24(18,19)20)23-11-10(17)9(16)8(15)7(5-14)21-11/h6-11,14-17H,3-5H2,1-2H3,(H,18,19,20)/b13-12+ |
| InChIKey | KEOFZEINZJWJPM-OUKQBFOZSA-N |
| XLogP | -1.26 |
| TPSA | 166.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|