C27H25N3O4S — CID 163142342
(1S,2S,6R,7R,11R)-11-hydroxy-3-(4-methoxyphenyl)-5-[(4-pyridin-2-ylphenyl)methyl]-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one (PubChem CID 163142342) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is (1S,2S,6R,7R,11R)-11-hydroxy-3-(4-methoxyphenyl)-5-[(4-pyridin-2-ylphenyl)methyl]-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one.
| Compound Name | (1S,2S,6R,7R,11R)-11-hydroxy-3-(4-methoxyphenyl)-5-[(4-pyridin-2-ylphenyl)methyl]-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one |
|---|---|
| PubChem CID | 163142342 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (1S,2S,6R,7R,11R)-11-hydroxy-3-(4-methoxyphenyl)-5-[(4-pyridin-2-ylphenyl)methyl]-4-sulfanylidene-8-oxa-3,5-diazatricyclo[5.2.2.02,6]undecan-9-one |
| SMILES | COc1ccc(N2C(=S)N(Cc3ccc(-c4ccccn4)cc3)[C@H]3[C@H]4OC(=O)[C@@H](C[C@H]4O)[C@@H]32)cc1 |
| InChI | InChI=1S/C27H25N3O4S/c1-33-19-11-9-18(10-12-19)30-23-20-14-22(31)25(34-26(20)32)24(23)29(27(30)35)15-16-5-7-17(8-6-16)21-4-2-3-13-28-21/h2-13,20,22-25,31H,14-15H2,1H3/t20-,22+,23-,24+,25-/m0/s1 |
| InChIKey | KFXQLXNHYFWWGH-LSYLRQOFSA-N |
| XLogP | 3.41 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|