C28H46N2O2 — CID 163142449
N-[1-[14-hydroxy-7,7,12,16-tetramethyl-6-(methylamino)-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]ethyl]-N-methylacetamide (PubChem CID 163142449) has the molecular formula C28H46N2O2 and a molecular weight of 442.69 g/mol. Its IUPAC name is N-[1-[14-hydroxy-7,7,12,16-tetramethyl-6-(methylamino)-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]ethyl]-N-methylacetamide.
| Compound Name | N-[1-[14-hydroxy-7,7,12,16-tetramethyl-6-(methylamino)-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 163142449 |
| Molecular Formula | C28H46N2O2 |
| Molecular Weight | 442.69 g/mol |
| Exact Mass | 442.36 |
| IUPAC Name | N-[1-[14-hydroxy-7,7,12,16-tetramethyl-6-(methylamino)-15-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-dienyl]ethyl]-N-methylacetamide |
| SMILES | CNC1CCC2=CC3=CCC4(C)C(C(C)N(C)C(C)=O)C(O)CC4(C)C3CCC2C1(C)C |
| InChI | InChI=1S/C28H46N2O2/c1-17(30(8)18(2)31)25-23(32)16-28(6)22-11-10-21-19(9-12-24(29-7)26(21,3)4)15-20(22)13-14-27(25,28)5/h13,15,17,21-25,29,32H,9-12,14,16H2,1-8H3 |
| InChIKey | KHGMPIKCFBZSOQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.69 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |