C29H27NO3 — CID 163142683
(19R)-1-ethyl-17-(2-propoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 163142683) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is (19R)-1-ethyl-17-(2-propoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (19R)-1-ethyl-17-(2-propoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 163142683 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (19R)-1-ethyl-17-(2-propoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CCCOc1ccccc1N1C(=O)C2[C@H](C1=O)C1c3ccccc3C2(CC)c2ccccc21 |
| InChI | InChI=1S/C29H27NO3/c1-3-17-33-23-16-10-9-15-22(23)30-27(31)25-24-18-11-5-7-13-20(18)29(4-2,26(25)28(30)32)21-14-8-6-12-19(21)24/h5-16,24-26H,3-4,17H2,1-2H3/t24?,25-,26?,29?/m1/s1 |
| InChIKey | KJDFMBVVUKIIQO-GEBOZVLWSA-N |
| XLogP | 5.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|