C11H8F9N3O3 — CID 163143607
4-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamoylamino]-N-hydroxybenzeneamine oxide (PubChem CID 163143607) has the molecular formula C11H8F9N3O3 and a molecular weight of 401.19 g/mol. Its IUPAC name is 4-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamoylamino]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamoylamino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163143607 |
| Molecular Formula | C11H8F9N3O3 |
| Molecular Weight | 401.19 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 4-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]carbamoylamino]-N-hydroxybenzeneamine oxide |
| SMILES | O=C(Nc1ccc([NH+]([O-])O)cc1)NC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8F9N3O3/c12-9(13,14)8(10(15,16)17,11(18,19)20)22-7(24)21-5-1-3-6(4-2-5)23(25)26/h1-4,23,25H,(H2,21,22,24) |
| InChIKey | KSCGFBNUBMULQU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|