C21H34N- — CID 163143615
methyl-[2,5,8-trimethyl-1-(3-methylbuta-1,3-dienyl)-2,3,3a,4,5a,6,7,8,8a,8b-decahydro-1H-acenaphthylen-5-yl]azanide (PubChem CID 163143615) has the molecular formula C21H34N- and a molecular weight of 300.51 g/mol. Its IUPAC name is methyl-[2,5,8-trimethyl-1-(3-methylbuta-1,3-dienyl)-2,3,3a,4,5a,6,7,8,8a,8b-decahydro-1H-acenaphthylen-5-yl]azanide.
| Compound Name | methyl-[2,5,8-trimethyl-1-(3-methylbuta-1,3-dienyl)-2,3,3a,4,5a,6,7,8,8a,8b-decahydro-1H-acenaphthylen-5-yl]azanide |
|---|---|
| PubChem CID | 163143615 |
| Molecular Formula | C21H34N- |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | methyl-[2,5,8-trimethyl-1-(3-methylbuta-1,3-dienyl)-2,3,3a,4,5a,6,7,8,8a,8b-decahydro-1H-acenaphthylen-5-yl]azanide |
| SMILES | C=C(C)C=CC1C(C)C2CCC(C)([N-]C)C3CCC(C)C1C23 |
| InChI | InChI=1S/C21H34N/c1-13(2)7-9-16-15(4)17-11-12-21(5,22-6)18-10-8-14(3)19(16)20(17)18/h7,9,14-20H,1,8,10-12H2,2-6H3/q-1 |
| InChIKey | XZOGGANNHHLXJF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|