C28H34N2O11 — CID 163144428
4-[2,3,4,5-tetrahydroxy-2-[1-hydroxy-2-[(2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl)peroxy]ethyl]pentyl]-3a,4-dihydropyrrolo[3,2-b]pyrrol-4-ium-5-olate (PubChem CID 163144428) has the molecular formula C28H34N2O11 and a molecular weight of 574.58 g/mol. Its IUPAC name is 4-[2,3,4,5-tetrahydroxy-2-[1-hydroxy-2-[(2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl)peroxy]ethyl]pentyl]-3a,4-dihydropyrrolo[3,2-b]pyrrol-4-ium-5-olate.
| Compound Name | 4-[2,3,4,5-tetrahydroxy-2-[1-hydroxy-2-[(2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl)peroxy]ethyl]pentyl]-3a,4-dihydropyrrolo[3,2-b]pyrrol-4-ium-5-olate |
|---|---|
| PubChem CID | 163144428 |
| Molecular Formula | C28H34N2O11 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 4-[2,3,4,5-tetrahydroxy-2-[1-hydroxy-2-[(2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl)peroxy]ethyl]pentyl]-3a,4-dihydropyrrolo[3,2-b]pyrrol-4-ium-5-olate |
| SMILES | Cc1cc(=O)c2cc3c(cc2o1)OC(C)(C)C(OOCC(O)C(O)(C[NH+]1C([O-])=CC2=NC=CC21)C(O)C(O)CO)C3 |
| InChI | InChI=1S/C28H34N2O11/c1-14-6-19(32)16-7-15-8-24(27(2,3)40-21(15)10-22(16)39-14)41-38-12-23(34)28(37,26(36)20(33)11-31)13-30-18-4-5-29-17(18)9-25(30)35/h4-7,9-10,18,20,23-24,26,31,33-37H,8,11-13H2,1-3H3 |
| InChIKey | KZOYXOGXJFPMHB-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 198.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|