About 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine
1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine (PubChem CID 163144630) has the molecular formula C15H21NO
and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine.
Molecular Properties
| Compound Name | 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine |
| PubChem CID | 163144630 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine |
| SMILES | CC1=CC[C@H]2COC(C3=CC=CN(C)C3)[C@@H]1C2 |
| InChI | InChI=1S/C15H21NO/c1-11-5-6-12-8-14(11)15(17-10-12)13-4-3-7-16(2)9-13/h3-5,7,12,14-15H,6,8-10H2,1-2H3/t12-,14-,15?/m1/s1 |
| InChIKey | LBEBNBXRCVCPOC-QRYBPTEFSA-N |
| XLogP | 2.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine?
The IUPAC name of 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine (CID 163144630) is 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine.
What is the SMILES notation for 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine?
The canonical SMILES for 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine is CC1=CC[C@H]2COC(C3=CC=CN(C)C3)[C@@H]1C2.
What is the InChIKey of 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine?
The InChIKey is LBEBNBXRCVCPOC-QRYBPTEFSA-N. The full InChI is InChI=1S/C15H21NO/c1-11-5-6-12-8-14(11)15(17-10-12)13-4-3-7-16(2)9-13/h3-5,7,12,14-15H,6,8-10H2,1-2H3/t12-,14-,15?/m1/s1.
What are the key properties of 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine?
1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine has a molecular weight of 231.34 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[(1R,5R)-8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl]-2H-pyridine is sourced from PubChem (CID 163144630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).