About CID 163145844
CID 163145844 (PubChem CID 163145844) has the molecular formula C52H69N3O8
and a molecular weight of 864.14 g/mol.
Molecular Properties
| Compound Name | CID 163145844 |
| PubChem CID | 163145844 |
| Molecular Formula | C52H69N3O8 |
| Molecular Weight | 864.14 g/mol |
| Exact Mass | 863.51 |
| IUPAC Name | — |
| SMILES | CC(O)CNCC1C2=C[C+](C(O)COc3cc(CCC4=C[C-](CO)C(CCCCCCC(N)CC5C=Cc6cc(CO)ccc6C5O)O4)ccc3O)N=C2C2C=CC13CCCC3C2 |
| InChI | InChI=1S/C52H69N3O8/c1-32(58)27-54-28-44-43-26-45(55-50(43)36-18-20-52(44)19-6-7-39(52)23-36)47(60)31-62-49-22-33(12-17-46(49)59)10-15-41-25-38(30-57)48(63-41)9-5-3-2-4-8-40(53)24-37-14-13-35-21-34(29-56)11-16-42(35)51(37)61/h11-14,16-18,20-22,25-26,32,36-37,39-40,44,47-48,51,54,56-61H,2-10,15,19,23-24,27-31,53H2,1H3 |
| InChIKey | LNNMMKQJWSBQHQ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 190.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
4 violations
| Rule | Value |
| MW ≤ 500 | 864.14 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 163145844 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163145844?
The IUPAC name of CID 163145844 (CID 163145844) is not available.
What is the SMILES notation for CID 163145844?
The canonical SMILES for CID 163145844 is CC(O)CNCC1C2=C[C+](C(O)COc3cc(CCC4=C[C-](CO)C(CCCCCCC(N)CC5C=Cc6cc(CO)ccc6C5O)O4)ccc3O)N=C2C2C=CC13CCCC3C2.
What is the InChIKey of CID 163145844?
The InChIKey is LNNMMKQJWSBQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C52H69N3O8/c1-32(58)27-54-28-44-43-26-45(55-50(43)36-18-20-52(44)19-6-7-39(52)23-36)47(60)31-62-49-22-33(12-17-46(49)59)10-15-41-25-38(30-57)48(63-41)9-5-3-2-4-8-40(53)24-37-14-13-35-21-34(29-56)11-16-42(35)51(37)61/h11-14,16-18,20-22,25-26,32,36-37,39-40,44,47-48,51,54,56-61H,2-10,15,19,23-24,27-31,53H2,1H3.
What are the key properties of CID 163145844?
CID 163145844 has a molecular weight of 864.14 g/mol, XLogP of 6.72, 22 rotatable bonds, 8 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163145844 is sourced from PubChem (CID 163145844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).