C26H28N2O10 — CID 163146072
(1,3-diacetyloxy-11-hydrazinylidene-4,5,9,10-tetrahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-2-yl) 2-methylpropanoate (PubChem CID 163146072) has the molecular formula C26H28N2O10 and a molecular weight of 528.51 g/mol. Its IUPAC name is (1,3-diacetyloxy-11-hydrazinylidene-4,5,9,10-tetrahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-2-yl) 2-methylpropanoate.
| Compound Name | (1,3-diacetyloxy-11-hydrazinylidene-4,5,9,10-tetrahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-2-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 163146072 |
| Molecular Formula | C26H28N2O10 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | (1,3-diacetyloxy-11-hydrazinylidene-4,5,9,10-tetrahydroxy-2-methyl-3,4-dihydro-1H-benzo[b]fluoren-2-yl) 2-methylpropanoate |
| SMILES | CC(=O)OC1C2=C(c3c(c(O)c4c(O)cccc4c3O)C2=NN)C(O)C(OC(C)=O)C1(C)OC(=O)C(C)C |
| InChI | InChI=1S/C26H28N2O10/c1-9(2)25(35)38-26(5)23(36-10(3)29)18-16(22(34)24(26)37-11(4)30)15-17(19(18)28-27)21(33)14-12(20(15)32)7-6-8-13(14)31/h6-9,22-24,31-34H,27H2,1-5H3 |
| InChIKey | INWXXPYNMWHKQX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 198.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|