C14H16ClN3O3S — CID 163146114
(3aR,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 163146114) has the molecular formula C14H16ClN3O3S and a molecular weight of 341.82 g/mol. Its IUPAC name is (3aR,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aR,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 163146114 |
| Molecular Formula | C14H16ClN3O3S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (3aR,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | NC(=O)[C@H]1C[C@@H](O)[C@H](O)[C@H]2N=C(Nc3ccc(Cl)cc3)S[C@@H]21 |
| InChI | InChI=1S/C14H16ClN3O3S/c15-6-1-3-7(4-2-6)17-14-18-10-11(20)9(19)5-8(13(16)21)12(10)22-14/h1-4,8-12,19-20H,5H2,(H2,16,21)(H,17,18)/t8-,9+,10+,11-,12+/m0/s1 |
| InChIKey | LQMGVAIARLXMTR-MTVMDMGHSA-N |
| XLogP | 0.82 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |