C15H26NO+ — CID 163146428
1-methyl-3-(8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl)piperidin-1-ium (PubChem CID 163146428) has the molecular formula C15H26NO+ and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-methyl-3-(8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl)piperidin-1-ium.
| Compound Name | 1-methyl-3-(8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl)piperidin-1-ium |
|---|---|
| PubChem CID | 163146428 |
| Molecular Formula | C15H26NO+ |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 1-methyl-3-(8-methyl-3-oxabicyclo[3.3.1]non-7-en-2-yl)piperidin-1-ium |
| SMILES | CC1=CCC2COC(C3CCC[NH+](C)C3)C1C2 |
| InChI | InChI=1S/C15H25NO/c1-11-5-6-12-8-14(11)15(17-10-12)13-4-3-7-16(2)9-13/h5,12-15H,3-4,6-10H2,1-2H3/p+1 |
| InChIKey | ICVIXGUBYIBLQS-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|