C29H45N3O4 — CID 163146501
3-[(3S,3aS,6R,7aS)-6-hydroxy-1,1,6-trimethyl-3-[(2-phenylacetyl)amino]-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 163146501) has the molecular formula C29H45N3O4 and a molecular weight of 499.70 g/mol. Its IUPAC name is 3-[(3S,3aS,6R,7aS)-6-hydroxy-1,1,6-trimethyl-3-[(2-phenylacetyl)amino]-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-morpholin-4-ylethyl)propanamide.
| Compound Name | 3-[(3S,3aS,6R,7aS)-6-hydroxy-1,1,6-trimethyl-3-[(2-phenylacetyl)amino]-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-morpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 163146501 |
| Molecular Formula | C29H45N3O4 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | 3-[(3S,3aS,6R,7aS)-6-hydroxy-1,1,6-trimethyl-3-[(2-phenylacetyl)amino]-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | CC1(C)C[C@H](NC(=O)Cc2ccccc2)[C@]2(CCC(=O)NCCN3CCOCC3)CC[C@@](C)(O)C[C@@H]12 |
| InChI | InChI=1S/C29H45N3O4/c1-27(2)21-24(31-26(34)19-22-7-5-4-6-8-22)29(12-11-28(3,35)20-23(27)29)10-9-25(33)30-13-14-32-15-17-36-18-16-32/h4-8,23-24,35H,9-21H2,1-3H3,(H,30,33)(H,31,34)/t23-,24-,28+,29+/m0/s1 |
| InChIKey | LUOAKEMZYMZEOM-OMICENBGSA-N |
| XLogP | 2.91 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |