C11H20N3O7- — CID 163146513
(2S,3R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-[hydroxy(oxido)amino]pentanedioic acid (PubChem CID 163146513) has the molecular formula C11H20N3O7- and a molecular weight of 306.30 g/mol. Its IUPAC name is (2S,3R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-[hydroxy(oxido)amino]pentanedioic acid.
| Compound Name | (2S,3R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-[hydroxy(oxido)amino]pentanedioic acid |
|---|---|
| PubChem CID | 163146513 |
| Molecular Formula | C11H20N3O7- |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2S,3R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-[hydroxy(oxido)amino]pentanedioic acid |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@H](C(=O)O)[C@@H](CC(=O)O)N([O-])O |
| InChI | InChI=1S/C11H20N3O7/c1-5(2)3-6(12)10(17)13-9(11(18)19)7(14(20)21)4-8(15)16/h5-7,9,20H,3-4,12H2,1-2H3,(H,13,17)(H,15,16)(H,18,19)/q-1/t6-,7+,9-/m0/s1 |
| InChIKey | OUXKKNYODIEJTQ-OOZYFLPDSA-N |
| XLogP | -1.04 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|