C21H32O6 — CID 163146653
2-(3,9-dihydroxy-6-methoxy-3,7-dimethyldeca-1,7-dienyl)-6-methoxy-3,5-dimethylpyran-4-one (PubChem CID 163146653) has the molecular formula C21H32O6 and a molecular weight of 380.48 g/mol. Its IUPAC name is 2-(3,9-dihydroxy-6-methoxy-3,7-dimethyldeca-1,7-dienyl)-6-methoxy-3,5-dimethylpyran-4-one.
| Compound Name | 2-(3,9-dihydroxy-6-methoxy-3,7-dimethyldeca-1,7-dienyl)-6-methoxy-3,5-dimethylpyran-4-one |
|---|---|
| PubChem CID | 163146653 |
| Molecular Formula | C21H32O6 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-(3,9-dihydroxy-6-methoxy-3,7-dimethyldeca-1,7-dienyl)-6-methoxy-3,5-dimethylpyran-4-one |
| SMILES | COc1oc(C=CC(C)(O)CCC(OC)C(C)=CC(C)O)c(C)c(=O)c1C |
| InChI | InChI=1S/C21H32O6/c1-13(12-14(2)22)17(25-6)8-10-21(5,24)11-9-18-15(3)19(23)16(4)20(26-7)27-18/h9,11-12,14,17,22,24H,8,10H2,1-7H3 |
| InChIKey | LVQGAOXDSKNQRU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|