C22H37ClN2O2S — CID 163147752
[(1R,2R,4aS,5S,8S,8aS)-8-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-2-hydroxy-5-isothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-methanidylazanium (PubChem CID 163147752) has the molecular formula C22H37ClN2O2S and a molecular weight of 429.07 g/mol. Its IUPAC name is [(1R,2R,4aS,5S,8S,8aS)-8-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-2-hydroxy-5-isothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-methanidylazanium.
| Compound Name | [(1R,2R,4aS,5S,8S,8aS)-8-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-2-hydroxy-5-isothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-methanidylazanium |
|---|---|
| PubChem CID | 163147752 |
| Molecular Formula | C22H37ClN2O2S |
| Molecular Weight | 429.07 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | [(1R,2R,4aS,5S,8S,8aS)-8-[(2R,5S)-5-chloro-2,6,6-trimethyloxan-2-yl]-2-hydroxy-5-isothiocyanato-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-1-yl]-methanidylazanium |
| SMILES | [CH2-][NH2+][C@@H]1[C@@H]2[C@@H]([C@@]3(C)CC[C@H](Cl)C(C)(C)O3)CC[C@](C)(N=C=S)[C@H]2CC[C@@]1(C)O |
| InChI | InChI=1S/C22H37ClN2O2S/c1-19(2)16(23)9-12-22(5,27-19)15-7-10-20(3,25-13-28)14-8-11-21(4,26)18(24-6)17(14)15/h14-18,26H,6-12,24H2,1-5H3/t14-,15-,16-,17-,18+,20-,21+,22+/m0/s1 |
| InChIKey | MFBICDOGDVVFLD-QJUHQHJTSA-N |
| XLogP | 3.71 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.07 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|