C22H18Cl4N2O4-2 — CID 163149204
6-[(1R,2R)-1,2-dichloro-2-phenylethyl]-4-[(1S,2R)-1,2-dichloro-2-phenylethyl]-1-N,1-N-dihydroxy-3-N,3-N-dioxidobenzene-1,3-diamine (PubChem CID 163149204) has the molecular formula C22H18Cl4N2O4-2 and a molecular weight of 516.21 g/mol. Its IUPAC name is 6-[(1R,2R)-1,2-dichloro-2-phenylethyl]-4-[(1S,2R)-1,2-dichloro-2-phenylethyl]-1-N,1-N-dihydroxy-3-N,3-N-dioxidobenzene-1,3-diamine.
| Compound Name | 6-[(1R,2R)-1,2-dichloro-2-phenylethyl]-4-[(1S,2R)-1,2-dichloro-2-phenylethyl]-1-N,1-N-dihydroxy-3-N,3-N-dioxidobenzene-1,3-diamine |
|---|---|
| PubChem CID | 163149204 |
| Molecular Formula | C22H18Cl4N2O4-2 |
| Molecular Weight | 516.21 g/mol |
| Exact Mass | 514.00 |
| IUPAC Name | 6-[(1R,2R)-1,2-dichloro-2-phenylethyl]-4-[(1S,2R)-1,2-dichloro-2-phenylethyl]-1-N,1-N-dihydroxy-3-N,3-N-dioxidobenzene-1,3-diamine |
| SMILES | [O-]N([O-])c1cc(N(O)O)c([C@@H](Cl)[C@H](Cl)c2ccccc2)cc1[C@H](Cl)[C@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C22H18Cl4N2O4/c23-19(13-7-3-1-4-8-13)21(25)15-11-16(18(28(31)32)12-17(15)27(29)30)22(26)20(24)14-9-5-2-6-10-14/h1-12,19-22,29-30H/q-2/t19-,20-,21-,22+/m1/s1 |
| InChIKey | DRUZOXDYRMJPSW-YSFYHYPLSA-N |
| XLogP | 7.59 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.21 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|