C19H25Cl3N3O4- — CID 163149716
N-[(1R)-1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-2,2,2-trichloroethyl]-3-[hydroxy(oxido)amino]benzamide (PubChem CID 163149716) has the molecular formula C19H25Cl3N3O4- and a molecular weight of 465.79 g/mol. Its IUPAC name is N-[(1R)-1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-2,2,2-trichloroethyl]-3-[hydroxy(oxido)amino]benzamide.
| Compound Name | N-[(1R)-1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-2,2,2-trichloroethyl]-3-[hydroxy(oxido)amino]benzamide |
|---|---|
| PubChem CID | 163149716 |
| Molecular Formula | C19H25Cl3N3O4- |
| Molecular Weight | 465.79 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N-[(1R)-1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-2,2,2-trichloroethyl]-3-[hydroxy(oxido)amino]benzamide |
| SMILES | O=C(N[C@H](OC[C@H]1CCCN2CCCC[C@H]12)C(Cl)(Cl)Cl)c1cccc(N([O-])O)c1 |
| InChI | InChI=1S/C19H25Cl3N3O4/c20-19(21,22)18(23-17(26)13-5-3-7-15(11-13)25(27)28)29-12-14-6-4-10-24-9-2-1-8-16(14)24/h3,5,7,11,14,16,18,27H,1-2,4,6,8-10,12H2,(H,23,26)/q-1/t14-,16-,18-/m1/s1 |
| InChIKey | NIVDTPJLHNTKDS-QGPMSJSTSA-N |
| XLogP | 4.09 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.79 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|