C17H29BrN2O — CID 163149787
1-(4-bromocyclohexyl)-2-(2,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl)ethanone (PubChem CID 163149787) has the molecular formula C17H29BrN2O and a molecular weight of 357.34 g/mol. Its IUPAC name is 1-(4-bromocyclohexyl)-2-(2,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl)ethanone.
| Compound Name | 1-(4-bromocyclohexyl)-2-(2,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl)ethanone |
|---|---|
| PubChem CID | 163149787 |
| Molecular Formula | C17H29BrN2O |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-(4-bromocyclohexyl)-2-(2,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-1-yl)ethanone |
| SMILES | CC1N(C)C2CCCCC2N1CC(=O)C1CCC(Br)CC1 |
| InChI | InChI=1S/C17H29BrN2O/c1-12-19(2)15-5-3-4-6-16(15)20(12)11-17(21)13-7-9-14(18)10-8-13/h12-16H,3-11H2,1-2H3 |
| InChIKey | JNRCYQUKLWVTBB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|