C26H41N5 — CID 163149793
7-[5-[(1S,2R,4aS,5R)-1,2,4a,5-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-9-methyl-8H-purin-6-amine (PubChem CID 163149793) has the molecular formula C26H41N5 and a molecular weight of 423.65 g/mol. Its IUPAC name is 7-[5-[(1S,2R,4aS,5R)-1,2,4a,5-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-9-methyl-8H-purin-6-amine.
| Compound Name | 7-[5-[(1S,2R,4aS,5R)-1,2,4a,5-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-9-methyl-8H-purin-6-amine |
|---|---|
| PubChem CID | 163149793 |
| Molecular Formula | C26H41N5 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.34 |
| IUPAC Name | 7-[5-[(1S,2R,4aS,5R)-1,2,4a,5-tetramethyl-2,3,4,5,6,7-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-9-methyl-8H-purin-6-amine |
| SMILES | CC(=CCN1CN(C)c2ncnc(N)c21)CC[C@]1(C)C2=CCC[C@@H](C)[C@]2(C)CC[C@H]1C |
| InChI | InChI=1S/C26H41N5/c1-18(12-15-31-17-30(6)24-22(31)23(27)28-16-29-24)10-13-25(4)20(3)11-14-26(5)19(2)8-7-9-21(25)26/h9,12,16,19-20H,7-8,10-11,13-15,17H2,1-6H3,(H2,27,28,29)/t19-,20-,25+,26+/m1/s1 |
| InChIKey | MXGORNADMFGTNH-RGOSMPGBSA-N |
| XLogP | 5.80 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|