C13H14N2O6 — CID 163150413
4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-N-hydroxybenzeneamine oxide (PubChem CID 163150413) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163150413 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-N-hydroxybenzeneamine oxide |
| SMILES | CC1(C)OC(=O)C(/C=N/c2ccc([NH+]([O-])O)cc2)C(=O)O1 |
| InChI | InChI=1S/C13H14N2O6/c1-13(2)20-11(16)10(12(17)21-13)7-14-8-3-5-9(6-4-8)15(18)19/h3-7,10,15,18H,1-2H3/b14-7+ |
| InChIKey | NDHHUQLAHUGTDW-VGOFMYFVSA-N |
| XLogP | 0.24 |
| TPSA | 112.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|