C57H68N4O13 — CID 163150649
CID 163150649 (PubChem CID 163150649) has the molecular formula C57H68N4O13 and a molecular weight of 1017.19 g/mol.
| Compound Name | CID 163150649 |
|---|---|
| PubChem CID | 163150649 |
| Molecular Formula | C57H68N4O13 |
| Molecular Weight | 1017.19 g/mol |
| Exact Mass | 1016.48 |
| IUPAC Name | — |
| SMILES | CCc1c2cc[nH]c2cn1-c1c2c(cc3c(=O)cc(C)oc13)CC(OOCC(O)(Cc1ccc(O)c3ccc(O)cc13)C(O)C(O)C(O)CO)C1(CC(C3CNC(=O)C3)C3CC4CCC5(CCCC5)NC4C1C3)O2 |
| InChI | InChI=1S/C57H68N4O13/c1-3-43-37-11-15-58-42(37)26-61(43)50-52-33(18-39-45(65)16-29(2)72-53(39)50)20-47(74-71-28-56(70,54(69)51(68)46(66)27-62)23-31-6-9-44(64)36-8-7-35(63)22-38(31)36)57(73-52)24-40(34-21-48(67)59-25-34)32-17-30-10-14-55(12-4-5-13-55)60-49(30)41(57)19-32/h6-9,11,15-16,18,22,26,30,32,34,40-41,46-47,49,51,54,58,60,62-64,66,68-70H,3-5,10,12-14,17,19-21,23-25,27-28H2,1-2H3,(H,59,67) |
| InChIKey | NFGXHIBELDYRQA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 261.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 74 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.19 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|