C48H75O10P — CID 163151249
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-icosa-8,11,14,17-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 163151249) has the molecular formula C48H75O10P and a molecular weight of 843.09 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-icosa-8,11,14,17-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-icosa-8,11,14,17-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 163151249 |
| Molecular Formula | C48H75O10P |
| Molecular Weight | 843.09 g/mol |
| Exact Mass | 842.51 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-icosa-8,11,14,17-tetraenoyloxypropan-2-yl] docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C48H75O10P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-48(52)58-46(44-57-59(53,54)56-42-45(50)41-49)43-55-47(51)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h5-8,11-14,17-20,22,24-25,27-28,30,34,36,45-46,49-50H,3-4,9-10,15-16,21,23,26,29,31-33,35,37-44H2,1-2H3,(H,53,54) |
| InChIKey | NKKUHWUBWLYVOR-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.09 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|