C84H98N4O12 — CID 163152019
CID 163152019 (PubChem CID 163152019) has the molecular formula C84H98N4O12 and a molecular weight of 1355.72 g/mol.
| Compound Name | CID 163152019 |
|---|---|
| PubChem CID | 163152019 |
| Molecular Formula | C84H98N4O12 |
| Molecular Weight | 1355.72 g/mol |
| Exact Mass | 1354.72 |
| IUPAC Name | — |
| SMILES | C/C=C(\C(=O)O[C@@H]1Cc2c3c(c4oc(CO)cc(=O)c4c2O)[C@@H]2C4=CCNC(N)=C4[C@@H]([C@H]4CCC5=C6C=C[C@@H](C)NC6NC=C5C[C@H]4[C@]1(C)O3)[C@@]1(CCC3(CCCC3)C1)Cc1ccc(O)cc1[C@H]2CO)[C@@]1(O)C[C@@H]2c3cccc4c3[C@]3(C=C[C@@H]2[C@@H]1C3)C[C@@]1(CC[C@H]2CCCC[C@]2(O)C1)[C@@H]4O |
| InChI | InChI=1S/C84H98N4O12/c1-4-60(84(97)35-58-50-20-26-80(36-62(50)84)41-82(74(94)55-12-9-11-51(58)69(55)80)25-19-46-10-5-6-24-83(46,96)42-82)77(95)99-64-33-57-71(93)67-63(92)32-48(38-89)98-73(67)68-65-54-21-29-86-75(85)66(54)70(81(28-27-79(40-81)22-7-8-23-79)34-44-14-15-47(91)31-56(44)59(65)39-90)53-18-17-49-45(30-61(53)78(64,3)100-72(57)68)37-87-76-52(49)16-13-43(2)88-76/h4,9,11-16,20-21,26,31-32,37,43,46,50,53,58-59,61-62,64-65,70,74,76,86-91,93-94,96-97H,5-8,10,17-19,22-25,27-30,33-36,38-42,85H2,1-3H3/b60-4+/t43-,46-,50+,53+,58+,59-,61-,62+,64-,65-,70-,74-,76?,78+,80+,81+,82-,83+,84+/m1/s1 |
| InChIKey | NRRHRGXSPYDQDI-SVPJSWSBSA-N |
| XLogP | 11.69 |
| TPSA | 269.46 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 100 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1355.72 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|