C9H15NO5 — CID 163152557
1-[(1S,2R,5R)-2-(carboxymethyl)-5-methyl-3-oxocyclopentyl]-N-hydroxymethanamine oxide (PubChem CID 163152557) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-[(1S,2R,5R)-2-(carboxymethyl)-5-methyl-3-oxocyclopentyl]-N-hydroxymethanamine oxide.
| Compound Name | 1-[(1S,2R,5R)-2-(carboxymethyl)-5-methyl-3-oxocyclopentyl]-N-hydroxymethanamine oxide |
|---|---|
| PubChem CID | 163152557 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-[(1S,2R,5R)-2-(carboxymethyl)-5-methyl-3-oxocyclopentyl]-N-hydroxymethanamine oxide |
| SMILES | C[C@@H]1CC(=O)[C@H](CC(=O)O)[C@H]1C[NH+]([O-])O |
| InChI | InChI=1S/C9H15NO5/c1-5-2-8(11)6(3-9(12)13)7(5)4-10(14)15/h5-7,10,14H,2-4H2,1H3,(H,12,13)/t5-,6-,7+/m1/s1 |
| InChIKey | NWUFKJYKLSJSSN-QYNIQEEDSA-N |
| XLogP | -0.93 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|