C13H20F3N3O4 — CID 163154414
1-N,1-N,3-N,3-N-tetrahydroxy-2-N,2-N-dipropyl-5-(trifluoromethyl)benzene-1,2,3-triamine (PubChem CID 163154414) has the molecular formula C13H20F3N3O4 and a molecular weight of 339.31 g/mol. Its IUPAC name is 1-N,1-N,3-N,3-N-tetrahydroxy-2-N,2-N-dipropyl-5-(trifluoromethyl)benzene-1,2,3-triamine.
| Compound Name | 1-N,1-N,3-N,3-N-tetrahydroxy-2-N,2-N-dipropyl-5-(trifluoromethyl)benzene-1,2,3-triamine |
|---|---|
| PubChem CID | 163154414 |
| Molecular Formula | C13H20F3N3O4 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-N,1-N,3-N,3-N-tetrahydroxy-2-N,2-N-dipropyl-5-(trifluoromethyl)benzene-1,2,3-triamine |
| SMILES | CCCN(CCC)c1c(N(O)O)cc(C(F)(F)F)cc1N(O)O |
| InChI | InChI=1S/C13H20F3N3O4/c1-3-5-17(6-4-2)12-10(18(20)21)7-9(13(14,15)16)8-11(12)19(22)23/h7-8,20-23H,3-6H2,1-2H3 |
| InChIKey | ONWOVUMGNGXDJO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|