C22H25O11+ — CID 163155652
(2R,3R,4R,5S)-2-[[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2H-chromen-1-ium-3-yl]oxy]oxane-3,4,5-triol (PubChem CID 163155652) has the molecular formula C22H25O11+ and a molecular weight of 465.43 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2H-chromen-1-ium-3-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-[[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2H-chromen-1-ium-3-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163155652 |
| Molecular Formula | C22H25O11+ |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | (2R,3R,4R,5S)-2-[[5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-2H-chromen-1-ium-3-yl]oxy]oxane-3,4,5-triol |
| SMILES | COc1cc(C2[OH+]c3cc(O)cc(O)c3C=C2O[C@H]2OC[C@H](O)[C@@H](O)[C@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C22H24O11/c1-29-15-3-9(4-16(30-2)19(15)27)21-17(33-22-20(28)18(26)13(25)8-31-22)7-11-12(24)5-10(23)6-14(11)32-21/h3-7,13,18,20-28H,8H2,1-2H3/p+1/t13-,18+,20+,21?,22+/m0/s1 |
| InChIKey | OZSGQVIRSHMMEC-SJJCZAFJSA-O |
| XLogP | 0.61 |
| TPSA | 171.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|