C14H22O2 — CID 163156469
1,5,5,7a-tetramethyl-2,3,6,7-tetrahydro-1H-indene-4-carboxylic acid (PubChem CID 163156469) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1,5,5,7a-tetramethyl-2,3,6,7-tetrahydro-1H-indene-4-carboxylic acid.
| Compound Name | 1,5,5,7a-tetramethyl-2,3,6,7-tetrahydro-1H-indene-4-carboxylic acid |
|---|---|
| PubChem CID | 163156469 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1,5,5,7a-tetramethyl-2,3,6,7-tetrahydro-1H-indene-4-carboxylic acid |
| SMILES | CC1CCC2=C(C(=O)O)C(C)(C)CCC21C |
| InChI | InChI=1S/C14H22O2/c1-9-5-6-10-11(12(15)16)13(2,3)7-8-14(9,10)4/h9H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | PHGGTDBZXHQBFS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |