C34H55N4O5+ — CID 163157580
4-[2-[2-(7-aminoheptyl)-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-(ethylamino)-2-[4-[1-(2-hydroxypropylamino)propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol (PubChem CID 163157580) has the molecular formula C34H55N4O5+ and a molecular weight of 599.84 g/mol. Its IUPAC name is 4-[2-[2-(7-aminoheptyl)-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-(ethylamino)-2-[4-[1-(2-hydroxypropylamino)propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol.
| Compound Name | 4-[2-[2-(7-aminoheptyl)-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-(ethylamino)-2-[4-[1-(2-hydroxypropylamino)propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol |
|---|---|
| PubChem CID | 163157580 |
| Molecular Formula | C34H55N4O5+ |
| Molecular Weight | 599.84 g/mol |
| Exact Mass | 599.42 |
| IUPAC Name | 4-[2-[2-(7-aminoheptyl)-3-(hydroxymethyl)-2H-furan-1-ium-5-id-5-yl]ethyl]-2-[2-(ethylamino)-2-[4-[1-(2-hydroxypropylamino)propan-2-yl]pyrrol-4-ylium-2-yl]ethoxy]phenol |
| SMILES | CCNC(COc1cc(CC[C-]2C=C(CO)C(CCCCCCCN)[OH+]2)ccc1O)C1=C[C+](C(C)CNCC(C)O)C=N1 |
| InChI | InChI=1S/C34H54N4O5/c1-4-37-31(30-18-27(21-38-30)24(2)19-36-20-25(3)40)23-42-34-16-26(12-14-32(34)41)11-13-29-17-28(22-39)33(43-29)10-8-6-5-7-9-15-35/h12,14,16-18,21,24-25,31,33,36-37,39-40,43H,4-11,13,15,19-20,22-23,35H2,1-3H3/p+1 |
| InChIKey | GHDZPXIMVFJSRS-UHFFFAOYSA-O |
| XLogP | 3.49 |
| TPSA | 145.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|