C32H27NO2 — CID 163157705
(1S,8S,15R,19S)-4-tert-butyl-17-naphthalen-1-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione (PubChem CID 163157705) has the molecular formula C32H27NO2 and a molecular weight of 457.57 g/mol. Its IUPAC name is (1S,8S,15R,19S)-4-tert-butyl-17-naphthalen-1-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione.
| Compound Name | (1S,8S,15R,19S)-4-tert-butyl-17-naphthalen-1-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 163157705 |
| Molecular Formula | C32H27NO2 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (1S,8S,15R,19S)-4-tert-butyl-17-naphthalen-1-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@@H]1c3ccccc3[C@@H]2[C@@H]2C(=O)N(c3cccc4ccccc34)C(=O)[C@H]12 |
| InChI | InChI=1S/C32H27NO2/c1-32(2,3)19-15-16-23-24(17-19)27-22-13-7-6-12-21(22)26(23)28-29(27)31(35)33(30(28)34)25-14-8-10-18-9-4-5-11-20(18)25/h4-17,26-29H,1-3H3/t26-,27-,28-,29+/m0/s1 |
| InChIKey | PTOBUZHYKLRAFC-XFTNXAEASA-N |
| XLogP | 6.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|