C13H14N3O4S- — CID 163158467
methyl 4-[4-[hydroxy(oxido)amino]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 163158467) has the molecular formula C13H14N3O4S- and a molecular weight of 308.34 g/mol. Its IUPAC name is methyl 4-[4-[hydroxy(oxido)amino]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-[4-[hydroxy(oxido)amino]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 163158467 |
| Molecular Formula | C13H14N3O4S- |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | methyl 4-[4-[hydroxy(oxido)amino]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(=S)NC1c1ccc(N([O-])O)cc1 |
| InChI | InChI=1S/C13H14N3O4S/c1-7-10(12(17)20-2)11(15-13(21)14-7)8-3-5-9(6-4-8)16(18)19/h3-6,11,18H,1-2H3,(H2,14,15,21)/q-1 |
| InChIKey | IOZLOXVZASKLNC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|