C21H21NO5 — CID 163159403
(6R)-3,8,9-trimethoxy-5-methyl-6H-benzo[c]phenanthridine-2,6-diol (PubChem CID 163159403) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is (6R)-3,8,9-trimethoxy-5-methyl-6H-benzo[c]phenanthridine-2,6-diol.
| Compound Name | (6R)-3,8,9-trimethoxy-5-methyl-6H-benzo[c]phenanthridine-2,6-diol |
|---|---|
| PubChem CID | 163159403 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (6R)-3,8,9-trimethoxy-5-methyl-6H-benzo[c]phenanthridine-2,6-diol |
| SMILES | COc1cc2c3c(ccc2cc1O)-c1cc(OC)c(OC)cc1[C@@H](O)N3C |
| InChI | InChI=1S/C21H21NO5/c1-22-20-12(6-5-11-7-16(23)17(25-2)8-13(11)20)14-9-18(26-3)19(27-4)10-15(14)21(22)24/h5-10,21,23-24H,1-4H3/t21-/m1/s1 |
| InChIKey | QKQWCUMFQCNNJC-OAQYLSRUSA-N |
| XLogP | 3.68 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |