C15H24O4 — CID 163159530
(2R,4S,5R,8S)-2,4,5-trihydroxy-2,5-dimethyl-8-propan-2-yl-4,6,7,8-tetrahydro-3H-naphthalen-1-one (PubChem CID 163159530) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (2R,4S,5R,8S)-2,4,5-trihydroxy-2,5-dimethyl-8-propan-2-yl-4,6,7,8-tetrahydro-3H-naphthalen-1-one.
| Compound Name | (2R,4S,5R,8S)-2,4,5-trihydroxy-2,5-dimethyl-8-propan-2-yl-4,6,7,8-tetrahydro-3H-naphthalen-1-one |
|---|---|
| PubChem CID | 163159530 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (2R,4S,5R,8S)-2,4,5-trihydroxy-2,5-dimethyl-8-propan-2-yl-4,6,7,8-tetrahydro-3H-naphthalen-1-one |
| SMILES | CC(C)[C@@H]1CC[C@@](C)(O)C2=C1C(=O)[C@](C)(O)C[C@@H]2O |
| InChI | InChI=1S/C15H24O4/c1-8(2)9-5-6-14(3,18)12-10(16)7-15(4,19)13(17)11(9)12/h8-10,16,18-19H,5-7H2,1-4H3/t9-,10-,14+,15+/m0/s1 |
| InChIKey | QLWMWNVUBQVSLJ-NBLIUIFLSA-N |
| XLogP | 1.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |