C26H36O9S — CID 163159579
[14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-3-sulfooxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 163159579) has the molecular formula C26H36O9S and a molecular weight of 524.63 g/mol. Its IUPAC name is [14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-3-sulfooxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-3-sulfooxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 163159579 |
| Molecular Formula | C26H36O9S |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | [14-hydroxy-10,13-dimethyl-17-(6-oxopyran-3-yl)-3-sulfooxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | CC(=O)OC1CC2(O)C3CCC4CC(OS(=O)(=O)O)CCC4(C)C3CCC2(C)C1c1ccc(=O)oc1 |
| InChI | InChI=1S/C26H36O9S/c1-15(27)34-21-13-26(29)20-6-5-17-12-18(35-36(30,31)32)8-10-24(17,2)19(20)9-11-25(26,3)23(21)16-4-7-22(28)33-14-16/h4,7,14,17-21,23,29H,5-6,8-13H2,1-3H3,(H,30,31,32) |
| InChIKey | QMJORECXNDJGSM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|