C13H16I2NO3- — CID 163159924
N-[2-[(1R,2S,3S,5R,6S,7S,8S,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethoxy]-N-oxidohydroxylamine (PubChem CID 163159924) has the molecular formula C13H16I2NO3- and a molecular weight of 488.08 g/mol. Its IUPAC name is N-[2-[(1R,2S,3S,5R,6S,7S,8S,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethoxy]-N-oxidohydroxylamine.
| Compound Name | N-[2-[(1R,2S,3S,5R,6S,7S,8S,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethoxy]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163159924 |
| Molecular Formula | C13H16I2NO3- |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 487.92 |
| IUPAC Name | N-[2-[(1R,2S,3S,5R,6S,7S,8S,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethoxy]-N-oxidohydroxylamine |
| SMILES | [O-]N(O)OCC[C@@]12[C@H]3[C@@H](I)[C@H]4[C@@H]5C[C@H]([C@@H]([C@H]53)[C@H]1I)[C@@H]42 |
| InChI | InChI=1S/C13H16I2NO3/c14-11-8-4-3-5-7-6(4)10(11)13(9(5)8,12(7)15)1-2-19-16(17)18/h4-12,17H,1-3H2/q-1/t4-,5-,6+,7+,8+,9+,10-,11+,12-,13-/m1/s1 |
| InChIKey | ZROBPVZZXFJXFS-NVUOIVTQSA-N |
| XLogP | 2.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|