C12H12O4 — CID 163159990
7-hydroxy-3,4,7-trimethylisochromene-6,8-dione (PubChem CID 163159990) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is 7-hydroxy-3,4,7-trimethylisochromene-6,8-dione.
| Compound Name | 7-hydroxy-3,4,7-trimethylisochromene-6,8-dione |
|---|---|
| PubChem CID | 163159990 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 7-hydroxy-3,4,7-trimethylisochromene-6,8-dione |
| SMILES | CC1=C(C)C2=CC(=O)C(C)(O)C(=O)C2=CO1 |
| InChI | InChI=1S/C12H12O4/c1-6-7(2)16-5-9-8(6)4-10(13)12(3,15)11(9)14/h4-5,15H,1-3H3 |
| InChIKey | QPVXXCCSELVKKM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|