C14H19N2O3- — CID 163160336
4-[6-[hydroxy(oxido)amino]-2-methyl-1,2,3,4-tetrahydroquinolin-7-yl]butan-2-one (PubChem CID 163160336) has the molecular formula C14H19N2O3- and a molecular weight of 263.32 g/mol. Its IUPAC name is 4-[6-[hydroxy(oxido)amino]-2-methyl-1,2,3,4-tetrahydroquinolin-7-yl]butan-2-one.
| Compound Name | 4-[6-[hydroxy(oxido)amino]-2-methyl-1,2,3,4-tetrahydroquinolin-7-yl]butan-2-one |
|---|---|
| PubChem CID | 163160336 |
| Molecular Formula | C14H19N2O3- |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 4-[6-[hydroxy(oxido)amino]-2-methyl-1,2,3,4-tetrahydroquinolin-7-yl]butan-2-one |
| SMILES | CC(=O)CCc1cc2c(cc1N([O-])O)CCC(C)N2 |
| InChI | InChI=1S/C14H19N2O3/c1-9-3-5-11-8-14(16(18)19)12(6-4-10(2)17)7-13(11)15-9/h7-9,15,18H,3-6H2,1-2H3/q-1 |
| InChIKey | NMPXRLPPWWNLNT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|