C66H81N5O7 — CID 163161701
CID 163161701 (PubChem CID 163161701) has the molecular formula C66H81N5O7 and a molecular weight of 1056.40 g/mol.
| Compound Name | CID 163161701 |
|---|---|
| PubChem CID | 163161701 |
| Molecular Formula | C66H81N5O7 |
| Molecular Weight | 1056.40 g/mol |
| Exact Mass | 1055.61 |
| IUPAC Name | — |
| SMILES | CCNC[C@@H]1[C@H]2c3[nH]ccc3[C@H]3CC(=O)C[C@H]4NC5(CCCCC5)[C@H]([C@H]5CC[C@@H]6[C@@H](CC[C@]7(C#C[C@H](C[C@H](O)[C@H](O)C[C@H](C8=CCNC(N)=C8)c8ccc9ccccc9c8)c8cc(O)c(OC)cc8CCC7=O)[C@@H]6O)[C@@H]15)[C@@H]2[C@@H]34 |
| InChI | InChI=1S/C66H81N5O7/c1-3-68-35-50-58-43-18-24-65(64(77)45(43)14-15-46(58)62-61-59-49(44-20-26-70-63(44)60(50)61)31-42(72)32-51(59)71-66(62)21-7-4-8-22-66)23-17-40(48-34-54(75)55(78-2)29-39(48)13-16-56(65)76)28-52(73)53(74)33-47(41-19-25-69-57(67)30-41)38-12-11-36-9-5-6-10-37(36)27-38/h5-6,9-12,19-20,26-27,29-30,34,40,43,45-47,49-53,58-62,64,68-71,73-75,77H,3-4,7-8,13-16,18,21-22,24-25,28,31-33,35,67H2,1-2H3/t40-,43-,45-,46+,47+,49-,50+,51-,52+,53-,58-,59+,60-,61-,62-,64-,65+/m1/s1 |
| InChIKey | RGGKWRBNDQWRRW-KHAPITEYSA-N |
| XLogP | 8.51 |
| TPSA | 202.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 78 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1056.40 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|